| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide Basic information |
| Product Name: | (1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide | | Synonyms: | (1S,4S)-2-PHENYLMETHYL-2,5-DIAZABICYCLO(2.2.1)HEPTANE 2HBR;(1S,4S)-2-BENZYL-2,5-DIAZABICYCLO(2.2.1)HEPTANE 2HBR;(1S,4S)-(+)-2-BENZYL-2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROBROMIDE;(1S,4S)-2-BENZYL-2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROBROMIDE;(1S,4S)-(+)-2-BENZYL-2,5-DI-AZA-BICYCLO[2.2.1]HEPTANE DIHYDROCHLORIDE;(1S,4S)-2-BENZYL-2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROBROMIDE 98+%;(1S,4S)-2-Benzyl-2,5-diazabicyclo[2.2.1] heptane dihydrobromides;(1S,4S)-(+)-2-BenzylL-2,5-diazabicyclo-(2 .2.1)heptane dihydrobromide | | CAS: | 116258-17-4 | | MF: | C12H16N2.2BrH | | MW: | 350.09 | | EINECS: | | | Product Categories: | Chiral;Chiral Building Blocks;Heterocyclic Building Blocks;Others | | Mol File: | 116258-17-4.mol | ![(1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide Structure](CAS/GIF/116258-17-4.gif) |
| | (1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide Chemical Properties |
| Melting point | 270 °C (dec.)(lit.) | | alpha | 16.5 º (C=3 IN 2 M NAOH) | | refractive index | 16 ° (C=3, 2mol/L NaOH) | | storage temp. | Store at room temperature, keep dry and cool | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +16.5°, c = 3 in 2 M NaOH | | Water Solubility | very faint turbidity | | InChI | 1S/C12H16N2.2BrH/c1-2-4-10(5-3-1)8-14-9-11-6-12(14)7-13-11;;/h1-5,11-13H,6-9H2;2*1H/t11-,12-;;/m0../s1 | | InChIKey | SOMPEQIPSQFVMO-AQEKLAMFSA-N | | SMILES | Br.Br.C1N[C@H]2C[C@@H]1N(C2)Cc3ccccc3 | | CAS DataBase Reference | 116258-17-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids |
| | (1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide Usage And Synthesis |
| Chemical Properties | Off-whitecrystal |
| | (1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide Preparation Products And Raw materials |
|