|
|
| | 1,3,5-Benzenetricarbonitrile,2,4,6-trimethyl- Basic information |
| Product Name: | 1,3,5-Benzenetricarbonitrile,2,4,6-trimethyl- | | Synonyms: | 2,4,6-trimethylbenzene-1,3,5-trimethylnitrile;2,4,6-trimethylbenzene-1,3,5-tricarbonitrile;1,3,5-Benzenetricarbonitrile,2,4,6-trimethyl- | | CAS: | 1206-85-5 | | MF: | C12H9N3 | | MW: | 195.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1206-85-5.mol |  |
| | 1,3,5-Benzenetricarbonitrile,2,4,6-trimethyl- Chemical Properties |
| Melting point | 182 °C | | Boiling point | 348.9±37.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C12H9N3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h1-3H3 | | InChIKey | WURVTDKUHZJPJX-UHFFFAOYSA-N | | SMILES | C1(C#N)=C(C)C(C#N)=C(C)C(C#N)=C1C |
| | 1,3,5-Benzenetricarbonitrile,2,4,6-trimethyl- Usage And Synthesis |
| | 1,3,5-Benzenetricarbonitrile,2,4,6-trimethyl- Preparation Products And Raw materials |
|