|
|
| | Ammonium hexachlororhodate(III) Basic information |
| Product Name: | Ammonium hexachlororhodate(III) | | Synonyms: | hexachlororhodium(3-);AMMONIUM HEXACHLORORHODATE (III), 99.99+%AMMONIUM HEXACHLORORHODATE (III), 99.99+%AMMONIUM HEXACHLORORHODATE (III), 99.99+%AMMONIUM HEXACHLORORHODATE (III), 99.99+%;hexachloro-,triammonium,(OC-6-11)-Rhodate(3-);hexachlororhodate(3-)triammonium;hexachloro-rhodate(3-triammonium;triammonium,(oc-6-11)-rhodate(3-hexachloro-;triammoniumhexachlororhodate(3-);RHODIUM AMMONIUM CHLORIDE | | CAS: | 15336-18-2 | | MF: | Cl6H4NRh-2 | | MW: | 333.65 | | EINECS: | 239-364-2 | | Product Categories: | Inorganics;halometallate salts;chemical reaction,pharm,electronic,materials | | Mol File: | 15336-18-2.mol |  |
| | Ammonium hexachlororhodate(III) Chemical Properties |
| density | 1.98[at 20℃] | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | H2O: slightly soluble(lit.) | | form | Powder | | color | Dark red | | Water Solubility | soluble | | Sensitive | Hygroscopic | | Exposure limits | ACGIH: TWA 0.01 mg/m3 NIOSH: IDLH 2 mg/m3; TWA 0.001 mg/m3 | | Stability: | hygroscopic | | InChI | InChI=1S/6ClH.H3N.Rh/h6*1H;1H3;/q;;;;;;;+3/p-5 | | InChIKey | VYHZQNSUDAYUBS-UHFFFAOYSA-I | | SMILES | [Rh+3]([Cl-])([Cl-])([Cl-])([Cl-])([Cl-])[Cl-].[NH4+] | | CAS DataBase Reference | 15336-18-2(CAS DataBase Reference) | | EPA Substance Registry System | Rhodate(3-), hexachloro-, triammonium, (OC-6-11)- (15336-18-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36/38 | | Safety Statements | 26-37/39-28A | | RIDADR | 3288 | | WGK Germany | 3 | | RTECS | VI8580166 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | Ammonium hexachlororhodate(III) Usage And Synthesis |
| Chemical Properties | DARK RED CRYSTALLINE POWDER | | Uses | Ammonium hexachlororhodate(III) hydrate is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals. | | Definition | ChEBI: Ammonium hexachlororhodate(III) is a salt comprising separate ammonium cations and octahedral [RhCl6](3-) anions. It contains a hexachlororhodate(3-). | | Flammability and Explosibility | Not classified |
| | Ammonium hexachlororhodate(III) Preparation Products And Raw materials |
|