| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (-)-alpha-Neoclovene Basic information |
| Product Name: | (-)-alpha-Neoclovene | | Synonyms: | 1,3a-Ethano-3aH-indene, 1,2,3,6,7,7a-hexahydro-2,2,4,7a-tetramethyl-, [1R-(1alpha,3aalpha,7aalpha)]-;(1S,7AS)-1,2,3,6,7,7A-HEXAHYDRO-2,2,4,7A-TETRAMETHYL-1,3-ETHANO-3AH-INDENE;(1s,7as)-1,2,3,6,7,7a-hexahydro-2,2,4,7a-tetramethyl-1,3a-ethano-3ah-indene;(-)-alpha-Neoclovene >=95.0% (sum of enantiomers, GC);1,3a-Ethano-3aH-indene, 1,2,3,6,7,7a-hexahydro-2,2,4,7a-tetramethyl-, (1R,3aS,7aS)-;(-?)?-?α-?Neoclovene;(?)-α-Neoclovene;Neoclovene | | CAS: | 4545-68-0 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | 4545-68-0.mol |  |
| | (-)-alpha-Neoclovene Chemical Properties |
| Boiling point | 256.5±7.0 °C(Predicted) | | density | 0.951 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.508 | | Fp | 114 °C | | storage temp. | 2-8°C | | form | liquid | | Optical Rotation | [α]20/D 79±2°, neat | | Henry's Law Constant | 2.9×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2015) | | Stability: | Stable. Keep cool. Store under argon. Photosensitive, protect from light. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C15H24/c1-11-6-5-8-14(4)12-7-9-15(11,14)10-13(12,2)3/h6,12H,5,7-10H2,1-4H3/t12,14-,15+/m0/s1 | | InChIKey | ZCJQJJWNFDNQGZ-JQXSQYPDSA-N | | SMILES | CC1=CCC[C@@]2(C)C3CC[C@@]12CC3(C)C |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 8-10-23 | | Storage Class | 10 - Combustible liquids |
| | (-)-alpha-Neoclovene Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | (-)-α-Neo58, clovene is a sesquiterpene obtained from ginseng (Panax sp.) and s considered a volatile compound and contributes to a strong aroma. Used in traditional Chinese medicine. |
| | (-)-alpha-Neoclovene Preparation Products And Raw materials |
|