| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Afatinib Impurity des-EJA Basic information |
| Product Name: | Afatinib Impurity des-EJA | | Synonyms: | Afatinib Impurity des-EJA;(2E)-N-[4-[(3-Chloro-4-fluorophenyl)amino]-7-[[(3S)-tetrahydro-3-furanyl]oxy]-6-quinazolinyl]-2-butenamide;2-Butenamide, N-[4-[(3-chloro-4-fluorophenyl)amino]-7-[[(3S)-tetrahydro-3-furanyl]oxy]-6-quinazolinyl]-, (2E)-;Afatinib des-EJA;Des(dimethylamino)-Afatinib;(S,E)-N-(4-((3-Chloro-4-fluorophenyl)amino)-7-((tetrahydrofuran-3-yl)oxy)quinazolin-6-yl)but-2-enamide (Afatinib Impurity);RMA-812 | | CAS: | 2223677-64-1 | | MF: | C22H20ClFN4O3 | | MW: | 442.87 | | EINECS: | | | Product Categories: | MX | | Mol File: | 2223677-64-1.mol |  |
| | Afatinib Impurity des-EJA Chemical Properties |
| Boiling point | 651.5±55.0 °C(Predicted) | | density | 1.420±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 12.48±0.43(Predicted) | | Appearance | Off-white to light yellow Solid | | InChIKey | IRSLBGKNPBBZSA-HSWBROFVSA-N | | SMILES | C(NC1C(O[C@H]2CCOC2)=CC2C(C=1)=C(NC1=CC=C(F)C(Cl)=C1)N=CN=2)(=O)/C=C/C |
| | Afatinib Impurity des-EJA Usage And Synthesis |
| Uses | Des(dimethylamino)-Afatinib is an impurity of Afatinib . Afatinib is an aminocrotonylamino-substituted quinazoline derivative used for treating cancer and diseases of the respiratory tract, lungs, gastrointestinal tract, bile duct, and gallbladder. |
| | Afatinib Impurity des-EJA Preparation Products And Raw materials |
|