| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
5alpha-Cholestan-3beta,5alpha-diol-6-one manufacturers
|
| | 5alpha-Cholestan-3beta,5alpha-diol-6-one Basic information |
| Product Name: | 5alpha-Cholestan-3beta,5alpha-diol-6-one | | Synonyms: | (3S,5R,8S,9S,10R,13R,14S,17R)-3,5-Dihydroxy-10,13-dimethyl-17-((R)-6-methylheptan-2-yl)tetradecahydro-1H-cyclopenta[a]phenanthren-6(10H)-one;5ALPHA-HYDROXY-6-KETO CHOLESTEROL;yakkasterone;3β,5-Dihydroxy-5α-cholestan-6-one;YS-64;5α-hydroxy-6-keto Cholesterol;CHOLESTANE-6-OXO-3,5-DIOL;CHOLESTANE-6-OXO-3BETA,5ALPHA-DIOL | | CAS: | 13027-33-3 | | MF: | C27H46O3 | | MW: | 418.65 | | EINECS: | | | Product Categories: | | | Mol File: | 13027-33-3.mol |  |
| | 5alpha-Cholestan-3beta,5alpha-diol-6-one Chemical Properties |
| Melting point | 234 °C | | Boiling point | 528.9±45.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 20 mg/ml; DMSO: 0.5 mg/ml; Ethanol: 5 mg/ml | | form | A crystalline solid | | pka | 12+-.0.70(Predicted) | | color | White to off-white | | InChIKey | SJZZRXMQSAXCFD-ZCBMJONGSA-N | | SMILES | O[C@]21[C@@]([C@@H]3[C@H]([C@H]4[C@@]([C@H](CC4)[C@@H](CCCC(C)C)C)(CC3)C)CC2=O)(CC[C@@H](C1)O)C |
| Storage Class | 11 - Combustible Solids |
| | 5alpha-Cholestan-3beta,5alpha-diol-6-one Usage And Synthesis |
| Uses | 5α-Hydroxy-6-keto Cholesterol Hydrochloride is a major metabolite of cholesterol. | | Definition | ChEBI: Cholestan-6-oxo-3,5-diol is a cholestanoid. | | Biological Activity | 6-keto-5α-hydroxycholesterol favors tumor progression. cholestan-6-oxo-3β,5α-diolelicits cytotoxicity towards human bronchial 16-HBE cells and plays a key role in mediating cell necrosis post ozone exposure. It is an oncometabolite, which promotes breast cancer progression and also blocks chemotaxis mediated by polymorphonuclear leukocytes. |
| | 5alpha-Cholestan-3beta,5alpha-diol-6-one Preparation Products And Raw materials |
|