| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (4-Methyl-piperazin-1-yl)-acetic acid Basic information |
| Product Name: | (4-Methyl-piperazin-1-yl)-acetic acid | | Synonyms: | 1-Piperazineaceticacid,4-methyl-(9CI);(4-METHYL-PIPERAZIN-1-YL)-ACETIC ACID >98%;1-Piperazineacetic acid, 4-Methyl-;N-(Carboxymethyl)-N'-methylpiperazine;(Carboxymethyl)-N'-methylpiperazine;AKOS BB-5221;AKOS BBS-00002665;4-METHYLPIPERAZINE-1-ACETIC ACID | | CAS: | 54699-92-2 | | MF: | C7H14N2O2 | | MW: | 158.2 | | EINECS: | | | Product Categories: | piperazines;PIPERIDINE | | Mol File: | 54699-92-2.mol |  |
| | (4-Methyl-piperazin-1-yl)-acetic acid Chemical Properties |
| Melting point | 130-133°C | | Boiling point | 278℃ | | density | 1.123 | | Fp | 122℃ | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 1.85±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C7H14N2O2/c1-8-2-4-9(5-3-8)6-7(10)11/h2-6H2,1H3,(H,10,11) | | InChIKey | JCXZKUZXVQKENT-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCN(C)CC1 | | CAS DataBase Reference | 54699-92-2(CAS DataBase Reference) |
| | (4-Methyl-piperazin-1-yl)-acetic acid Usage And Synthesis |
| Uses | (Carboxymethyl)-N'-methylpiperazine acts as a potential antibacterial compound, due to its nocathiacin analog. | | Uses | (Carboxymethyl)-N''-methylpiperazine acts as a potential antibacterial compound, due to its nocathiacin analog. | | Synthesis | b) Synthesis of 4-methyl-1-piperazinylacetic acid
Ethyl (4-methyl-1-piperazinyl) acetate (1.3 g, 6.50 mmol, 1.0 eq.) was dissolved in 8N hydrochloric acid and the reaction was stirred at 95°C for 16 hours. After completion of the reaction, the reaction solution was concentrated by vacuum rotary evaporator. The remaining hydrochloric acid was neutralized with sodium bicarbonate solution and subsequently extracted with ethyl acetate (3 x 10 ml). The organic phases were combined, washed sequentially with water and saturated saline and dried over anhydrous sodium sulfate. The organic solvent was removed by distillation under reduced pressure to afford the target product 4-methyl-1-piperazineacetic acid in 54.5% yield (0.6 g).LC-MS (ESI) analysis: theoretical mass: 158.0; measured mass: 159.1 [M + H]+ (retention time: 0.102 min). | | References | [1] Patent: WO2013/53983, 2013, A1. Location in patent: Page/Page column 38 [2] Journal of Medicinal Chemistry, 2000, vol. 43, # 8, p. 1489 - 1494 [3] Patent: EP2107054, 2009, A1. Location in patent: Page/Page column 26 |
| | (4-Methyl-piperazin-1-yl)-acetic acid Preparation Products And Raw materials |
|