| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Methyl-4-nitrobenzhydrazide Basic information |
| | 3-Methyl-4-nitrobenzhydrazide Chemical Properties |
| Melting point | 147-149°C | | form | solid | | InChI | 1S/C8H9N3O3/c1-5-4-6(8(12)10-9)2-3-7(5)11(13)14/h2-4H,9H2,1H3,(H,10,12) | | InChIKey | SMRIMKXHORAHJR-UHFFFAOYSA-N | | SMILES | Cc1cc(ccc1[N+]([O-])=O)C(=O)NN | | CAS DataBase Reference | 72198-83-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2928009090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Methyl-4-nitrobenzhydrazide Usage And Synthesis |
| | 3-Methyl-4-nitrobenzhydrazide Preparation Products And Raw materials |
|