| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:4-[Bis(2-hydroxyethyl)aMino]benzylideneMalononitrile, 95% CAS:63619-34-1 Package:1g Remarks:H51081
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:4-(2,2-Dicyanovinyl)-N-bis(hydroxyethyl)aniline CAS:63619-34-1 Purity:95% Package:1G Remarks:632279-1G
|
|
| | 4-(2 2-DICYANOVINYL)-N-BIS(HYDROXYETHYL& Basic information |
| | 4-(2 2-DICYANOVINYL)-N-BIS(HYDROXYETHYL& Chemical Properties |
| Melting point | 83 °C (dec.)(lit.) | | Boiling point | 520.2±50.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | form | solid | | pka | 14.14±0.10(Predicted) | | InChI | 1S/C14H15N3O2/c15-10-13(11-16)9-12-1-3-14(4-2-12)17(5-7-18)6-8-19/h1-4,9,18-19H,5-8H2 | | InChIKey | CYBYVNMREDBMAT-UHFFFAOYSA-N | | SMILES | OCCN(CCO)c1ccc(cc1)\C=C(\C#N)C#N |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 4-(2 2-DICYANOVINYL)-N-BIS(HYDROXYETHYL& Usage And Synthesis |
| | 4-(2 2-DICYANOVINYL)-N-BIS(HYDROXYETHYL& Preparation Products And Raw materials |
|