|
|
| | 3 4-(2' 2'-DIMETHYLPROPYLENE)DIOXYTHIOPH Basic information |
| Product Name: | 3 4-(2' 2'-DIMETHYLPROPYLENE)DIOXYTHIOPH | | Synonyms: | 3 4-(2' 2'-DIMETHYLPROPYLENE)DIOXYTHIOPH;EDOT analog, 3,4-Dihydro-3,3-dimethyl-2H-thieno[3,4-b-1,4]dioxepin;2H-Thieno[3,4-b][1,4]dioxepin, 3,4-dihydro-3,3-dimethyl-;3,4-(2,2-Dimethylpropylenedioxy)thiophene 97%;3,3-dimethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine;3,3-Dimethyl-3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine;3,4-(2,2-Dimethylpropylenedioxy)thio;3,4-(2,2-Dimethylpropylenedioxy)thi | | CAS: | 255901-50-9 | | MF: | C9H12O2S | | MW: | 184.26 | | EINECS: | 200-582-5 | | Product Categories: | | | Mol File: | 255901-50-9.mol |  |
| | 3 4-(2' 2'-DIMETHYLPROPYLENE)DIOXYTHIOPH Chemical Properties |
| Melting point | 41-46 °C | | Boiling point | 239.6±9.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | Fp | 209 °F | | storage temp. | Storage temp. 2-8°C | | form | powder to lump | | color | White to Yellow to Green | | InChI | InChI=1S/C9H12O2S/c1-9(2)5-10-7-3-12-4-8(7)11-6-9/h3-4H,5-6H2,1-2H3 | | InChIKey | PUEUIEYRIVFGLS-UHFFFAOYSA-N | | SMILES | O1CC(C)(C)COC2=CSC=C12 |
| WGK Germany | 3 | | HS Code | 2934.99.9001 | | Storage Class | 11 - Combustible Solids |
| | 3 4-(2' 2'-DIMETHYLPROPYLENE)DIOXYTHIOPH Usage And Synthesis |
| | 3 4-(2' 2'-DIMETHYLPROPYLENE)DIOXYTHIOPH Preparation Products And Raw materials |
|