| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)- manufacturers
|
| | TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)- Basic information |
| | TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)- Chemical Properties |
| Melting point | 204-210 °C(lit.) | | Boiling point | 307.948±52.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.314±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 9.575±0.43(predicted) | | form | solid | | InChI | 1S/C9H8BF3O2/c11-9(12,13)8-3-1-7(2-4-8)5-6-10(14)15/h1-6,14-15H/b6-5+ | | InChIKey | BBNQFBHQOPZKTI-AATRIKPKSA-N | | SMILES | [H]\C(B(O)O)=C(\[H])c1ccc(cc1)C(F)(F)F |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)- Usage And Synthesis |
| Uses | trans-2-[4-(Trifluoromethyl)phenyl]vinylboronic Acid is used in preparation of novel chromane, isochromane, thiochromane, or tetrahydroquinoline derivatives as glucosylceramide synthase (GCS) inhibitors. | | Uses | Reactant for: Microwave-assisted Suzuki-Miyaura cross-coupling Cobalt-catalyzed coupling reactions Preparation of vinylic MIDA boronates Synthesis of C2-aryl pyrrolobenzodiazepine antitumor agents Suzuki-Miyaura cross-coupling reaction |
| | TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)- Preparation Products And Raw materials |
|