|
|
| | E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC& Basic information |
| Product Name: | E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC& | | Synonyms: | E-2-(2,4-Difluorophenyl)vinylboronic acid, pinacol ester;(E)-2-(2,4-Difluorostyryl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;trans-2-(2,4-Difluorophenyl)vinylboronic acid pinacol ester 96%;E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC;E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC&;2-[(E)-2-(2,4-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[(1E)-2-(2,4-difluorophenyl)ethenyl]-4,4,5,5-tetramethyl-;trans-2-(2,4-Difluorophenyl)vinylboronic acid pinacol ester | | CAS: | 736987-78-3 | | MF: | C14H17BF2O2 | | MW: | 266.09 | | EINECS: | | | Product Categories: | | | Mol File: | 736987-78-3.mol |  |
| | E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC& Chemical Properties |
| Boiling point | 103-105 °C0.2-0.3 mm Hg | | density | 1.099 g/mL at 25 °C | | refractive index | n20/D 1.503 | | Fp | >230 °F | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C14H17BF2O2/c1-13(2)14(3,4)19-15(18-13)8-7-10-5-6-11(16)9-12(10)17/h5-9H,1-4H3/b8-7+ | | InChIKey | BMZXZTQQERUFEM-BQYQJAHWSA-N | | SMILES | CC1(C)OB(OC1(C)C)\C=C\c2ccc(F)cc2F |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 12 - Non Combustible Liquids |
| | E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC& Usage And Synthesis |
| | E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC& Preparation Products And Raw materials |
|