| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-Dimethyl-1-adamantanemethanol Basic information |
| Product Name: | 3,5-Dimethyl-1-adamantanemethanol | | Synonyms: | (3,5-Dimethyladamantan-1-yl)methanol;3,5-Dimethyl-1-(hydroxymethyl)adamantane;3,5-Dimethyltricyclo[3.3.1.13,7]decane-1-methanol;3,5-DIMETHYLADAMANTANE-1-METHANOL, 97%;3,5-DIMETHYL-1-ADAMANTANEMETHANOL, 98%(GC);3,5-Dimethyl-1-(hydroxymethyl)adamantane, 3,5-Dimethyltricyclo[3.3.1.13,7]decane-1-methanol;3,5-Dimethyl-1-adamantanemethanol>;Tricyclo[3.3.1.13,7]decane-1-methanol, 3,5-dimethyl- | | CAS: | 26919-42-6 | | MF: | C13H22O | | MW: | 194.31 | | EINECS: | | | Product Categories: | Alcohols;Building Blocks;C11 to C30+;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Adamantanes | | Mol File: | 26919-42-6.mol |  |
| | 3,5-Dimethyl-1-adamantanemethanol Chemical Properties |
| Melting point | 58-62 °C | | Boiling point | 115 °C / 3mmHg | | density | 1.066±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 121.4±8.6℃ | | solubility | soluble in Methanol | | form | Solid | | pka | 15.04±0.10(Predicted) | | color | White | | InChI | 1S/C13H22O/c1-11-3-10-4-12(2,6-11)8-13(5-10,7-11)9-14/h10,14H,3-9H2,1-2H3/t10-,11+,12-,13- | | InChIKey | RVWLWJAOIBEWAV-WNGYAQOMSA-N | | SMILES | C[C@]12CC3C[C@](C)(C1)CC(CO)(C3)C2 |
| WGK Germany | 3 | | HS Code | 2904200090 | | Storage Class | 11 - Combustible Solids |
| | 3,5-Dimethyl-1-adamantanemethanol Usage And Synthesis |
| | 3,5-Dimethyl-1-adamantanemethanol Preparation Products And Raw materials |
|