| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 4-Pentylphenyl 4-methylbenzoate Basic information |
| Product Name: | 4-Pentylphenyl 4-methylbenzoate | | Synonyms: | Benzoic acid,4-methyl-, 4-pentylphenyl ester;4-PENTYLPHENYL 4-METHYLBENZOATE, 97;4-pentylphenyl p-toluate;4-Pentylphenyl-4'-Methylbenzoate,1.5-DaeaC19H22O2;4-n-Pentylphenyl-4-methylbenzoate;4-Pentylphenyl-methyl-benzoate;4-PENTYLPHENYL-4''-METHYLBENZOATE,99.5%;4-Pentylphenyl 4-methylbenzoate | | CAS: | 50649-59-7 | | MF: | C19H22O2 | | MW: | 282.38 | | EINECS: | 256-683-2 | | Product Categories: | | | Mol File: | 50649-59-7.mol |  |
| | 4-Pentylphenyl 4-methylbenzoate Chemical Properties |
| Melting point | 34-38 °C | | Boiling point | 409.3±34.0 °C(Predicted) | | density | 1.040±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid crystal | | Appearance | White to off-white Solid | | InChI | 1S/C19H22O2/c1-3-4-5-6-16-9-13-18(14-10-16)21-19(20)17-11-7-15(2)8-12-17/h7-14H,3-6H2,1-2H3 | | InChIKey | OFNFLSYTTLXGBM-UHFFFAOYSA-N | | SMILES | CCCCCc1ccc(OC(=O)c2ccc(C)cc2)cc1 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 4-Pentylphenyl 4-methylbenzoate Usage And Synthesis |
| Uses | Intermediates of Liquid Crystals |
| | 4-Pentylphenyl 4-methylbenzoate Preparation Products And Raw materials |
|