| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Pentylphenyl 4-propylbenzoate Basic information |
| | 4-Pentylphenyl 4-propylbenzoate Chemical Properties |
| Melting point | 15-18℃ | | Boiling point | 433.9±34.0 °C(Predicted) | | density | 0.989 g/mL at 25 °C | | refractive index | n20/D 1.543 | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid crystal | | InChI | 1S/C21H26O2/c1-3-5-6-8-18-11-15-20(16-12-18)23-21(22)19-13-9-17(7-4-2)10-14-19/h9-16H,3-8H2,1-2H3 | | InChIKey | WNBFPAKRCJNBBS-UHFFFAOYSA-N | | SMILES | CCCCCc1ccc(OC(=O)c2ccc(CCC)cc2)cc1 | | CAS DataBase Reference | 50649-60-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 4-propyl-, 4-pentylphenyl ester (50649-60-0) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 4-Pentylphenyl 4-propylbenzoate Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | Intermediates of Liquid Crystals |
| | 4-Pentylphenyl 4-propylbenzoate Preparation Products And Raw materials |
|