|
|
| | Homopiperazine-1,4-bis(2-ethanesulfonic acid) Basic information |
| Product Name: | Homopiperazine-1,4-bis(2-ethanesulfonic acid) | | Synonyms: | HOMOPIPERAZINE-1 4-BIS(2-ETHANESULFONIC&;Homopiperazine-1,4-bis-(2-ethanesufonicacid);Hexahydro-1H-1,4-diazepine-1,4-bis(2-ethanesulfonic acid), Homo-PIPES;HoMopiperazine-N,N'-bis-[2-(ethanesulfonic acid)] DisodiuM Salt;1H-1,4-Diazepine-1,4(5H)-diethanesulfonic acid, tetrahydro-;Tetrahydro-1H-1,4-diazepine-1,4(5H)-diethanesulfonic Acid;HOMOPIPERAZINE-1,4-BIS(2-ETHANESULFONIC ACID);Homopiperazine-N,N'-bis-[2-(ethanesulfonic acid) | | CAS: | 202185-84-0 | | MF: | C9H20N2O6S2 | | MW: | 316.39 | | EINECS: | | | Product Categories: | Amines;Heterocycles;Sulfur & Selenium Compounds;buffer | | Mol File: | 202185-84-0.mol |  |
| | Homopiperazine-1,4-bis(2-ethanesulfonic acid) Chemical Properties |
| density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Store at RT. | | solubility | H2O: 10 mg/mL, clear, colorless | | pka | 0.54±0.50(Predicted) | | form | Solid | | color | White | | InChI | 1S/C9H20N2O6S2/c12-18(13,14)8-6-10-2-1-3-11(5-4-10)7-9-19(15,16)17/h1-9H2,(H,12,13,14)(H,15,16,17) | | InChIKey | QZTMPPUJIVQNKS-UHFFFAOYSA-N | | SMILES | OS(=O)(=O)CCN1CCCN(CC1)CCS(O)(=O)=O |
| Hazard Codes | C | | Risk Statements | 21-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2585 8/PG 3 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29339900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Skin Corr. 1B |
| | Homopiperazine-1,4-bis(2-ethanesulfonic acid) Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | Homopiperazine-1,4-bis(2-ethanesulfonic acid) can be used in the immunoassay studies and as pretreatment reagents and methods, and application to assays for immunosuppressant drugs. | | General Description | Homopiperazine-1,4-bis(2-ethanesulfonic acid) is used as a buffer in experiments involving plant cells at low pH. |
| | Homopiperazine-1,4-bis(2-ethanesulfonic acid) Preparation Products And Raw materials |
|