| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:3-Chloro-4,5-dimethoxybenzaldehyde
CAS:18268-68-3
Purity:95+% Remarks:B34336
|
| Company Name: |
Hunan Hui Bai Shi Biotechnology Co., Ltd.
|
| Tel: |
0731-85526065 13308475853 |
| Email: |
ivy@hnhbsj.com |
| Products Intro: |
Product Name:3-Chloro-4,5-Dimethoxybenzaldehyde
CAS:18268-68-3
Purity:97% Package:250mg;
1g;
5g;
|
|
| | 3-CHLORO-4 5-DIMETHOXYBENZALDEHYDE 97 Basic information |
| | 3-CHLORO-4 5-DIMETHOXYBENZALDEHYDE 97 Chemical Properties |
| Melting point | 56-60 °C(lit.) | | Boiling point | 301.8±37.0 °C(Predicted) | | density | 1.245 | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | InChI | 1S/C9H9ClO3/c1-12-8-4-6(5-11)3-7(10)9(8)13-2/h3-5H,1-2H3 | | InChIKey | AMZCHEDPEAQEMC-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cc(Cl)c(OC)c(OC)c1 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 3-CHLORO-4 5-DIMETHOXYBENZALDEHYDE 97 Usage And Synthesis |
| | 3-CHLORO-4 5-DIMETHOXYBENZALDEHYDE 97 Preparation Products And Raw materials |
|