| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Trimethylsilylethynyl-3 5-dimethoxybe& Basic information |
| Product Name: | 1-Trimethylsilylethynyl-3 5-dimethoxybe& | | Synonyms: | 1-(3,5-dimethoxyphenyl)-2-(trimethylsilyl)acetylene;1-trimethylsilylethynyl-3,5-dimethoxyben;3,5-dimethoxy-1-(trimethylsilylethynyl)benzene;1-trimethylsilylethynyl-3;3,5-Dimethoxy-1-(trimethylsilylethynyl)benzene, [(3,5-Dimethoxyphenyl)ethynyl]trimethylsilane;3,5-Dimethoxy-1-(trimethylsilylethynyl)benzen;Benzene, 1,3-dimethoxy-5-[2-(trimethylsilyl)ethynyl]-;1,3-Dimethoxy-5-[2-(trimethylsilyl)ethynyl]benzene | | CAS: | 400608-30-2 | | MF: | C13H18O2Si | | MW: | 234.37 | | EINECS: | | | Product Categories: | | | Mol File: | 400608-30-2.mol |  |
| | 1-Trimethylsilylethynyl-3 5-dimethoxybe& Chemical Properties |
| Melting point | 61-65 °C(lit.) | | Boiling point | 300.4±42.0 °C(Predicted) | | density | 0.99±0.1 g/cm3(Predicted) | | InChI | 1S/C13H18O2Si/c1-14-12-8-11(6-7-16(3,4)5)9-13(10-12)15-2/h8-10H,1-5H3 | | InChIKey | DGSBDARVIGVKSP-UHFFFAOYSA-N | | SMILES | COc1cc(OC)cc(c1)C#C[Si](C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Trimethylsilylethynyl-3 5-dimethoxybe& Usage And Synthesis |
| | 1-Trimethylsilylethynyl-3 5-dimethoxybe& Preparation Products And Raw materials |
|