| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 3-[5-(4-Chlorophenyl)furan-2-yl]acrylic acid Basic information |
| | 3-[5-(4-Chlorophenyl)furan-2-yl]acrylic acid Chemical Properties |
| Melting point | 195-199 °C(lit.) | | Boiling point | 417.6±40.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | pka | 4.28±0.10(Predicted) | | form | solid | | InChI | 1S/C13H9ClO3/c14-10-3-1-9(2-4-10)12-7-5-11(17-12)6-8-13(15)16/h1-8H,(H,15,16)/b8-6+ | | InChIKey | FPSINWFYJYHUBV-SOFGYWHQSA-N | | SMILES | OC(=O)\C=C\c1ccc(o1)-c2ccc(Cl)cc2 |
| Hazard Codes | Xi,N | | Risk Statements | 41-50/53 | | Safety Statements | 26-39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 |
| | 3-[5-(4-Chlorophenyl)furan-2-yl]acrylic acid Usage And Synthesis |
| | 3-[5-(4-Chlorophenyl)furan-2-yl]acrylic acid Preparation Products And Raw materials |
|