| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
1 6-Bis(p-carboxyphenoxy)hexane manufacturers
|
| | 1 6-Bis(p-carboxyphenoxy)hexane Basic information |
| | 1 6-Bis(p-carboxyphenoxy)hexane Chemical Properties |
| Melting point | 278-290 °C | | Boiling point | 580.1±35.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.18±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C20H22O6/c21-19(22)15-5-9-17(10-6-15)25-13-3-1-2-4-14-26-18-11-7-16(8-12-18)20(23)24/h5-12H,1-4,13-14H2,(H,21,22)(H,23,24) | | InChIKey | FQJXYULOQZUKBZ-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(OCCCCCCOc2ccc(cc2)C(O)=O)cc1 |
| Hazard Codes | Xi,N | | Risk Statements | 43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| | 1 6-Bis(p-carboxyphenoxy)hexane Usage And Synthesis |
| Uses | Building block for polyanhydrides, a class of bioerodible polymer with drug delivery applications.1 |
| | 1 6-Bis(p-carboxyphenoxy)hexane Preparation Products And Raw materials |
|