2-bromo-1-phenylhexan-1-one manufacturers
|
| | 2-bromo-1-phenylhexan-1-one Basic information |
| Product Name: | 2-bromo-1-phenylhexan-1-one | | Synonyms: | 1-Hexanone, 2-bromo-1-phenyl-;2-bromo-1-phenylhexan-1-one;2-bromohexanophenone;2-Brom-1-phenyl-hexan-1-on;2-bromo-1-phenylhexan-1-one2-bromo-1-phenylhexan-1-one | | CAS: | 59774-06-0 | | MF: | C12H15BrO | | MW: | 255.15 | | EINECS: | 200-797-7 | | Product Categories: | | | Mol File: | 59774-06-0.mol |  |
| | 2-bromo-1-phenylhexan-1-one Chemical Properties |
| Boiling point | 98 °C(Press: 0.3 Torr) | | density | 1.272±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H15BrO/c1-2-3-9-11(13)12(14)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3 | | InChIKey | MQIJCWVCTPNMKW-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)C(Br)CCCC |
| | 2-bromo-1-phenylhexan-1-one Usage And Synthesis |
| Uses | This product is sold as designer drug on the illicit drug market. |
| | 2-bromo-1-phenylhexan-1-one Preparation Products And Raw materials |
|