- Piperophos
-
- $1980.00 / 50mg
-
2026-01-04
- CAS:24151-93-7
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | PIPEROPHOS Basic information |
| | PIPEROPHOS Chemical Properties |
| Melting point | <25℃ | | Boiling point | 250°C | | density | 1.153±0.06 g/cm3(Predicted) | | Fp | >100 °C | | storage temp. | 0-6°C | | pka | -0.87±0.40(Predicted) | | form | liquid | | Water Solubility | 25mg/L(20 ºC) | | BRN | 8395577 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | agriculture
environmental | | InChI | 1S/C14H28NO3PS2/c1-4-10-17-19(20,18-11-5-2)21-12-14(16)15-9-7-6-8-13(15)3/h13H,4-12H2,1-3H3 | | InChIKey | UNLYSVIDNRIVFJ-UHFFFAOYSA-N | | SMILES | CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C | | EPA Substance Registry System | Phosphorodithioic acid, S-[2-(2-methyl-1-piperidinyl)-2-oxoethyl] O,O-dipropyl ester (24151-93-7) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | 3018 | | WGK Germany | 3 | | RTECS | TE3690000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | PIPEROPHOS Usage And Synthesis |
| Chemical Properties | dark brown liquid | | Uses | Piperophos is a pesticide used in agriculture for prevention of fungal diseases and insect infestation. | | Definition | ChEBI: Piperophos is a N-acylpiperidine. |
| | PIPEROPHOS Preparation Products And Raw materials |
|