| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
tert-Butyl tetraisopropylphosphorodiamidite manufacturers
|
| | tert-Butyl tetraisopropylphosphorodiamidite Basic information |
| Product Name: | tert-Butyl tetraisopropylphosphorodiamidite | | Synonyms: | tert-Butyl tetraisopropylphosphorodiamidite 95%;tert-Butyl-N,N,N',N'-tetraisopropylphosphorodiamidite;N-[[di(propan-2-yl)amino]-[(2-methylpropan-2-yl)oxy]phosphanyl]-N-propan-2-ylpropan-2-amine;[tert-butyloxy]bis(N,N-diisopropylamino)phosphane;Phosphorodiamidous acid, N,N,N',N'-tetrakis(1-methylethyl)-, 1,1-dimethylethyl ester;5-Pyrimidinecarboxylicacid,4-chloro-4-(methylthio)-;T1-tert-butoxy-N,N,N',N'-tetraisopropylphosphanediamine;1-tert-butoxy-N,N,N',N'-tetraisopropylphosphinediamine | | CAS: | 137348-88-0 | | MF: | C16H37N2OP | | MW: | 304.45 | | EINECS: | | | Product Categories: | Organic Building Blocks;Phosphoramidites;Phosphorus Compounds | | Mol File: | 137348-88-0.mol |  |
| | tert-Butyl tetraisopropylphosphorodiamidite Chemical Properties |
| Melting point | 67-74 °C (lit.) | | Boiling point | 330.1±25.0 °C(Predicted) | | storage temp. | 2-8°C | | pka | 7.68±0.70(Predicted) | | form | solid | | InChI | InChI=1S/C16H37N2OP/c1-12(2)17(13(3)4)20(19-16(9,10)11)18(14(5)6)15(7)8/h12-15H,1-11H3 | | InChIKey | PSFUFSJCFKUIIG-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(N(C(C)C)C(C)C)OC(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | tert-Butyl tetraisopropylphosphorodiamidite Usage And Synthesis |
| Uses | tert-Butyl Tetraisopropylphosphorodiamidite acts as a reagent in the synthesis of aromatic oxophosphorus compounds via michaelis-arbov type of reaction of arynes. |
| | tert-Butyl tetraisopropylphosphorodiamidite Preparation Products And Raw materials |
|