| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
6-Mb-cAMP sodium salt manufacturers
|
| | 6-Mb-cAMP sodium salt Basic information |
| | 6-Mb-cAMP sodium salt Chemical Properties |
| Melting point | >200°C (dec.) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White Off-White | | biological source | synthetic (organic) | | Water Solubility | water: 50mg/mL, clear, colorless | | Stability: | Hygroscopic | | InChI | 1S/C14H18N5O7P.Na.H/c1-2-3-8(20)18-12-9-13(16-5-15-12)19(6-17-9)14-10(21)11-7(25-14)4-24-27(22,23)26-11;;/h5-7,10-11,14,21H,2-4H2,1H3,(H,22,23)(H,15,16,18,20);; | | InChIKey | RHNOUOJKQVKESB-UHFFFAOYSA-N | | SMILES | [Na].CCCC(=O)Nc1ncnc2n(cnc12)C3OC4COP(O)(=O)OC4C3O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 6-Mb-cAMP sodium salt Usage And Synthesis |
| Uses | N6-Monobutyryladenosine 3′:5′-cyclic monophosphate sodium salt is suitable:
- to test the hypothesis that it stimulates the long-lasting potentiation of post ganglionic response
- as protein kinase A activator, in human primary cultured thyrocytes for analyzing the modulations in cAMP cascade regulated gene expression
- to analyse its effect on progesterone production in corpus luteum isolated from pseudopregnant rabbits
| | Biochem/physiol Actions | Membrane permeable analog of cAMP that activates protein kinase A and is resistant to degradation by phosphodiesterase |
| | 6-Mb-cAMP sodium salt Preparation Products And Raw materials |
|