| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-(Trifluoromethylthio)acetophenone Basic information |
| Product Name: | 4-(Trifluoromethylthio)acetophenone | | Synonyms: | 1-(4-TRIFLUOROMETHYLSULFANYL-PHENYL)-ETHANONE;4-TRIFLUOROMETHYLMERCAPTOACETOPHENONE;4-(Trifluromethylthio)acetophenone;Ethanone, 1-[4-[(trifluoromethyl)thio]phenyl]-;1-(4-((Trifluoromethyl)thio)phenyl)ethan-1-one;1-(4-((Trifluoromethyl)thio)phenyl)ethanone;4′-(Trifluoromethylthio)acetophenone, CAS 713-67-7;4'-(Trifluoromethylthio)acetophenone | | CAS: | 713-67-7 | | MF: | C9H7F3OS | | MW: | 220.21 | | EINECS: | | | Product Categories: | | | Mol File: | 713-67-7.mol |  |
| | 4-(Trifluoromethylthio)acetophenone Chemical Properties |
| Melting point | 28-32℃ | | Boiling point | 115-117 °C(Press: 20 Torr) | | density | 1.32±0.1 g/cm3(Predicted) | | form | liquid | | color | Clear, almost colourless | | InChI | 1S/C9H7F3OS/c1-6(13)7-2-4-8(5-3-7)14-9(10,11)12/h2-5H,1H3 | | InChIKey | TXNFKHHYTGEPRL-UHFFFAOYSA-N | | SMILES | FC(F)(F)Sc1ccc(cc1)C(=O)C |
| Hazard Codes | T,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | HazardClass | TOXIC | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(Trifluoromethylthio)acetophenone Usage And Synthesis |
| Uses | 4''-(Trifluoromethylthio)acetophenone is used in preparation of alpha-fluorochalcone derivatives and its application in preparation of drug for treatment of PPAR receptor-related diseases. |
| | 4-(Trifluoromethylthio)acetophenone Preparation Products And Raw materials |
|