3,5-Dibromo-4-methoxybenzoic acid manufacturers
|
| | 3,5-Dibromo-4-methoxybenzoic acid Basic information |
| | 3,5-Dibromo-4-methoxybenzoic acid Chemical Properties |
| Melting point | 224 °C | | Boiling point | 365.2±42.0 °C(Predicted) | | density | 1.957±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 3.69±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C8H6Br2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12) | | InChIKey | NAHPGFGVWWKSFU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Br)=C(OC)C(Br)=C1 | | CAS DataBase Reference | 4073-35-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2918999090 |
| | 3,5-Dibromo-4-methoxybenzoic acid Usage And Synthesis |
| Uses | 3,5-Dibromo-4-methoxybenzoic acid (3,5-Dibromo-p-anisic acid) is a brominated alkaloid that can be isolated from sponges such as Amphimedon sp. and Psammaplysilla purpurea[1][2]. | | References | [1] Campos P E, et al. Amphimedonoic acid and psammaplysene E, novel brominated alkaloids from Amphimedon sp[J]. Tetrahedron Letters, 2017, 58(40): 3901-3904.
[2] Kallscheuer N, et al. The bacterial phylum Planctomycetes as novel source for bioactive small molecules[J]. Biotechnology advances, 2021, 53: 107818. DOI:10.1016/j.biotechadv.2021.107818 |
| | 3,5-Dibromo-4-methoxybenzoic acid Preparation Products And Raw materials |
|