| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | 3,3'-(1,3-Phenylenedioxy)dianiline-15N2 Basic information |
| Product Name: | 3,3'-(1,3-Phenylenedioxy)dianiline-15N2 | | Synonyms: | 3,3'-(1,3-PHENYLENEDIOXY)DIANILINE-15N2, 99 ATOM % 15N;1,3-bis(3-amino-15n-phenoxy)benzene;3,3′-(1,3-Phenylenedioxy)dianiline-15N2;3,3'-(1,3-Phenylenedioxy)dianiline-15N2 | | CAS: | 287476-23-7 | | MF: | C18H16N2O2 | | MW: | 294.35 | | EINECS: | | | Product Categories: | | | Mol File: | 287476-23-7.mol |  |
| | 3,3'-(1,3-Phenylenedioxy)dianiline-15N2 Chemical Properties |
| Melting point | 107-109 °C(lit.) | | InChI | 1S/C18H16N2O2/c19-13-4-1-6-15(10-13)21-17-8-3-9-18(12-17)22-16-7-2-5-14(20)11-16/h1-12H,19-20H2/i19+1,20+1 | | InChIKey | DKKYOQYISDAQER-QTKWTTPSSA-N | | SMILES | [15NH2]c1cccc(Oc2cccc(Oc3cccc([15NH2])c3)c2)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3,3'-(1,3-Phenylenedioxy)dianiline-15N2 Usage And Synthesis |
| | 3,3'-(1,3-Phenylenedioxy)dianiline-15N2 Preparation Products And Raw materials |
|