| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-Keto-3-methylbutyric acid-13C5, 3-d1 sodium salt Basic information |
| Product Name: | 2-Keto-3-methylbutyric acid-13C5, 3-d1 sodium salt | | Synonyms: | Sodium α-ketoisovalerate-13C5,3-d1;2-Keto-3-methylbutyric acid-13C5,3-d sodium salt;2-Ketoisovaleric acid-13C5,3-d sodium salt;3-Methyl-2-oxobutanoic acid-13C5,3-d sodium salt;Ketovaline-13C5,3-d sodium salt;Sodium 3-methyl-2-oxobutyrate-13C5,3-d;α-Keto-3-methylbutyric acid-13C5,3-d sodium;α-Ketoisovaleric acid-13C5,3-d sodium salt | | CAS: | 420095-74-5 | | MF: | C5H6DNaO3 | | MW: | 144.15 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Keto-3-methylbutyric acid-13C5, 3-d1 sodium salt Chemical Properties |
| Melting point | 227-230 °C (lit.) | | form | solid | | InChI | 1S/C5H8O3.Na/c1-3(2)4(6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1/i1+1,2+1,3+1D,4+1,5+1; | | InChIKey | WIQBZDCJCRFGKA-MLIDLTAPSA-M | | SMILES | [Na+].[2H][13C]([13CH3])([13CH3])[13C](=O)[13C]([O-])=O | | CAS Number Unlabeled | 3715-29-5 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Keto-3-methylbutyric acid-13C5, 3-d1 sodium salt Usage And Synthesis |
| Uses | A labelled α-keto ester derivative. |
| | 2-Keto-3-methylbutyric acid-13C5, 3-d1 sodium salt Preparation Products And Raw materials |
|