2-NAPHTHYL ACRYLATE manufacturers
|
| | 2-NAPHTHYL ACRYLATE Basic information |
| | 2-NAPHTHYL ACRYLATE Chemical Properties |
| Melting point | 38-42 °C (lit.) | | Boiling point | 138℃/0.4mm | | density | 1.147 | | Fp | >230 °C | | form | solid | | λmax | 220 nm | | InChI | InChI=1S/C13H10O2/c1-2-13(14)15-12-8-7-10-5-3-4-6-11(10)9-12/h2-9H,1H2 | | InChIKey | SLVJUZOHXPZVLR-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C2C(=C1)C=CC=C2)(=O)C=C |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-NAPHTHYL ACRYLATE Usage And Synthesis |
| | 2-NAPHTHYL ACRYLATE Preparation Products And Raw materials |
|