|
|
| | 4-([6-(Methacryloyloxy)hexyl]oxy)benzenecarboxylic acid Basic information |
| Product Name: | 4-([6-(Methacryloyloxy)hexyl]oxy)benzenecarboxylic acid | | Synonyms: | 4-[6-(2-METHYL-ACRYLOXY)-HEXYLOXY]-BENZOIC ACID;4-[6-(2-METHYL-ACRYLOYLOXY)HEXYLOXY]BENZOIC ACID;4-(6-METHACRYLOYLOXY-N-HEX-1-YLOXY)BENZOIC ACID;4-[[6-[(2-methyl-1-oxo-2-propen-1-yl)oxy]hexyl]oxy]Benzoic acid;4-((6-(methacryloyloxy)hexyl)oxy)benzoic acid;Benzoic acid, 4-[[6-[(2-methyl-1-oxo-2-propen-1-yl)oxy]hexyl]oxy]-;4-[[6-[(2-methyl-1-oxo-2-propenyl)oxy]hexyl]oxy]-Benzoic acid;4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoic acid | | CAS: | 91652-00-5 | | MF: | C17H22O5 | | MW: | 306.35 | | EINECS: | | | Product Categories: | | | Mol File: | 91652-00-5.mol | ![4-([6-(Methacryloyloxy)hexyl]oxy)benzenecarboxylic acid Structure](CAS/GIF/91652-00-5.gif) |
| | 4-([6-(Methacryloyloxy)hexyl]oxy)benzenecarboxylic acid Chemical Properties |
| Melting point | 75-79 °C(Solv: isopropanol (67-63-0)) | | Boiling point | 457.9±25.0 °C(Predicted) | | density | 1.122±0.06 g/cm3(Predicted) | | pka | 4.48±0.10(Predicted) | | InChI | InChI=1S/C17H22O5/c1-13(2)17(20)22-12-6-4-3-5-11-21-15-9-7-14(8-10-15)16(18)19/h7-10H,1,3-6,11-12H2,2H3,(H,18,19) | | InChIKey | KAGIRXVDTGQWKF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OCCCCCCOC(=O)C(C)=C)C=C1 |
| | 4-([6-(Methacryloyloxy)hexyl]oxy)benzenecarboxylic acid Usage And Synthesis |
| Uses | 4-{[6-(Methacryloyloxy)hexyl]oxy}benzenecarboxylic acid is a useful research chemical compound. | | Preparation | The preparation of 4-([6-(methacryloyloxy)hexyl]oxy)benzenecarboxylic acid is as follows:6-(4-Formylphenoxy)hexyl methacrylate in an amount of 116.14 g, 2100 mL of methanol, an aqueous sodium dihydrogen phosphate solution (obtained by dissolving 43 g of sodium dihydrogen phosphate dihydrate in 570 mL of water) and 73 mL of a 30% hydrogen peroxide solution were added one by one. An aqueous sodium chlorite solution (obtained by dissolving 61.9 g of sodium chlorite with the purity of 80% in 500 mL of water) was added by dropping. After dropping, the reaction liquid was stirred at 45° C. for 3 hours, and the reaction was finished. After slowly cooling the reaction liquid to 20° C., 2250 mL of water was dropped to the reaction liquid, and a solid was precipitated. The solid was collected by filtration, and 72.7 g of 4-((6-(methacryloyloxy)hexyl)oxy)benzoic acid was thus obtained. 
|
| | 4-([6-(Methacryloyloxy)hexyl]oxy)benzenecarboxylic acid Preparation Products And Raw materials |
|