| Company Name: |
China Langchem Inc. Gold |
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl-d3 p-toluenesulfonate Basic information |
| Product Name: | Methyl-d3 p-toluenesulfonate | | Synonyms: | (methyl-d3) 4-methylbenzenesulfonate;Methyl?p-toluenesulfonate-d3;4-Methyl benzenesulfonate-d3;Methy-d3 (toluenesulfonate);trideuteriomethyl 4-methylbenzenesulfonate;Methy-d;D3-(p-Toluenesulfonyl)methylester;D3-paramethylbenzenesulfonylacylmethyl ester | | CAS: | 7575-93-1 | | MF: | C8H7D3O3S | | MW: | 189.25 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 7575-93-1.mol |  |
| | Methyl-d3 p-toluenesulfonate Chemical Properties |
| Boiling point | 82-84 °C(Press: 0.001 Torr) | | solubility | Acetone (Slightly), Methanol (Slightly) | | form | solid | | color | Off-white | | InChI | InChI=1S/C8H10O3S/c1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3/i2D3 | | InChIKey | VUQUOGPMUUJORT-BMSJAHLVSA-N | | SMILES | S(=O)(=O)(OC([2H])([2H])[2H])C1=CC=C(C)C=C1 |
| | Methyl-d3 p-toluenesulfonate Usage And Synthesis |
| Uses | Methyl-d3 Toluenesulfonate is labelled Methyl Toluenesulfonate which was used to prepare rhodacyanine dyes as antimalarials. It was also used to synthesize of fascaplysin derivatives with CDK4 inhibitory activities. |
| | Methyl-d3 p-toluenesulfonate Preparation Products And Raw materials |
|