|
|
| | SEBACIC ACID DI-N-OCTYL ESTER Basic information |
| Product Name: | SEBACIC ACID DI-N-OCTYL ESTER | | Synonyms: | 1,10-dioctyl decanedioate;decadioic acid, dioctyl ester;Decanedioic acid, dioctyl ester;decanedioicaciddioctylester;DI-N-OCTYL SEBACATE;DECANEDIOIC ACID DI-N-OCTYL ESTER;SEBACIC ACID DI-N-OCTYL ESTER;SEBACIC ACID DIOCTYL ESTER | | CAS: | 2432-87-3 | | MF: | C26H50O4 | | MW: | 426.67 | | EINECS: | 219-411-3 | | Product Categories: | bc0001 | | Mol File: | 2432-87-3.mol |  |
| | SEBACIC ACID DI-N-OCTYL ESTER Chemical Properties |
| Melting point | 18°C | | Boiling point | 256℃ | | density | 0.912 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.451 | | Fp | 210℃ | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Water Solubility | 3.856ng/L at 25℃ | | FreezingPoint | -48℃ | | Dielectric constant | 4.0(27℃) | | InChI | InChI=1S/C26H50O4/c1-3-5-7-9-15-19-23-29-25(27)21-17-13-11-12-14-18-22-26(28)30-24-20-16-10-8-6-4-2/h3-24H2,1-2H3 | | InChIKey | MIMDHDXOBDPUQW-UHFFFAOYSA-N | | SMILES | C(OCCCCCCCC)(=O)CCCCCCCCC(OCCCCCCCC)=O | | LogP | 10.23 at 25℃ | | CAS DataBase Reference | 2432-87-3(CAS DataBase Reference) | | EPA Substance Registry System | Decanedioic acid, dioctyl ester (2432-87-3) |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | SEBACIC ACID DI-N-OCTYL ESTER Usage And Synthesis |
| Chemical Properties | It is a liquid between -55°C (pour point) and 248°C (boiling point at
4 mmHg). | | Uses | Dioctyl sebacate is used as a plasticizer. | | Flammability and Explosibility | Not classified |
| | SEBACIC ACID DI-N-OCTYL ESTER Preparation Products And Raw materials |
|