| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-(4-Dimethylaminobenzylidene)rhodanine Basic information |
| | 5-(4-Dimethylaminobenzylidene)rhodanine Chemical Properties |
| Melting point | 285-288 °C(lit.) | | density | 1.36±0.1 g/cm3 (20 ºC 760 Torr) | | bulk density | 225kg/m3 | | refractive index | 1.5950 (estimate) | | storage temp. | Store below +30°C. | | solubility | dioxane: soluble0.1g/10 mL (hot) | | form | Fluffy Powder | | pka | 8.17±0.30(Predicted) | | color | Red | | Water Solubility | Insoluble in water, 993.7(mg/L) at 25°C | | λmax | 451 nm | | Merck | 14,3231 | | BRN | 189065 | | InChI | 1S/C12H12N2OS2/c1-14(2)9-5-3-8(4-6-9)7-10-11(15)13-12(16)17-10/h3-7H,1-2H3,(H,13,15,16)/b10-7+ | | InChIKey | JJRVRELEASDUMY-JXMROGBWSA-N | | SMILES | CN(C)c1ccc(cc1)\C=C2\SC(=S)NC2=O | | CAS DataBase Reference | 536-17-4(CAS DataBase Reference) | | EPA Substance Registry System | 4-Thiazolidinone, 5-[[4-(dimethylamino)phenyl]methylene]-2-thioxo- (536-17-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37-26 | | WGK Germany | 3 | | RTECS | VI8090000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 5-(4-Dimethylaminobenzylidene)rhodanine Usage And Synthesis |
| Chemical Properties | red fluffy powder | | Uses | As 0.03% solution in acetone for detection of silver, mercury, copper, gold, platinum and palladium ions. | | Uses | Applied for the detection of Ag, Au, Cu, Hg, Pd, Pt, alkaloids, antipyrin, indican, sulfonamide, urobilinogen. Reagent for the determination of silver, palladium, mercury and gold. Also used in the photometric determination of auto radiograms. | | Uses | 5-(4-Dimethylaminobenzylidene)rhodanine is a silver-specific dye that is used to quantitate the autoradiographic deposition of silver onto X-ray film in a colorimetric assay. 5-(4-Dimethylaminobenzylidene)rhodanine is used as an indicator in the titration of cyanide solution with silver nitrate solution. | | Safety Profile | Poison by
intraperitoneal route. When heated to
decomposition it emits very toxic fumes of
NOx and SOx |
| | 5-(4-Dimethylaminobenzylidene)rhodanine Preparation Products And Raw materials |
|