| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | 2,3-Bis(4-chlorophenyl)-5-phenyltetrazolium chloride Basic information |
| | 2,3-Bis(4-chlorophenyl)-5-phenyltetrazolium chloride Chemical Properties |
| solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C5H3F7O2/c6-2(7)4(8,9)1-14-3(13)5(10,11)12/h2H,1H2 | | InChIKey | AUTAPTQTFVZDGP-UHFFFAOYSA-M | | SMILES | [Cl-].Clc1ccc(cc1)[n+]2[n](nc(n2)c4ccccc4)c3ccc(cc3)Cl |
| WGK Germany | WGK 3 | | HS Code | 2933.99.9701 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 2,3-Bis(4-chlorophenyl)-5-phenyltetrazolium chloride Usage And Synthesis |
| | 2,3-Bis(4-chlorophenyl)-5-phenyltetrazolium chloride Preparation Products And Raw materials |
|