| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine Basic information |
| Product Name: | 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine | | Synonyms: | IFLAB-BB F1126-0518;BUTTPARK 59\40-36;OTAVA-BB BB0123751066;[1]BENZOTHIENO[2,3-D]PYRIMIDINE, 4-CHLORO-5,6,7,8-TETRAHYDRO-;AKOS 92587;AKOS BBS-00004607;AKOS USSH-4110760;4-CHLORO-5,6,7,8-TETRAHYDRO[1]BENZOTHIENO[2,3-D]PYRIMIDINE | | CAS: | 40493-18-3 | | MF: | C10H9ClN2S | | MW: | 224.71 | | EINECS: | | | Product Categories: | | | Mol File: | 40493-18-3.mol | ![4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine Structure](CAS/GIF/40493-18-3.gif) |
| | 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine Chemical Properties |
| Melting point | 228℃ (N,N-dimethylformamide water ) | | Boiling point | 377.2±37.0 °C(Predicted) | | density | 1.419±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.82±0.20(Predicted) | | form | solid | | Appearance | Light yellow to green yellow Solid | | InChI | 1S/C10H9ClN2S/c11-9-8-6-3-1-2-4-7(6)14-10(8)13-5-12-9/h5H,1-4H2 | | InChIKey | PRNJDUCSVXTOTN-UHFFFAOYSA-N | | SMILES | ClC1=NC=NC2=C1C(CCCC3)=C3S2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine Usage And Synthesis |
| | 4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine Preparation Products And Raw materials |
|