|
|
| | O-Methylisourea hemisulfate Basic information |
| Product Name: | O-Methylisourea hemisulfate | | Synonyms: | Bis(2-methylisouronium) sulphate;carbamimidic acid methyl ester hemisulfate;bis(2-Methylisouronium) sulfate.;2-METHYLISO-UREASULFATE;O-Methylisoharnstoffsulfat;methyl isourea,sulfate;O-METHYLISOUREA HEMISULFATE;O-METHYLISOUREA SULFATE | | CAS: | 52328-05-9 | | MF: | C4H14N4O6S | | MW: | 246.24 | | EINECS: | 257-851-8 | | Product Categories: | | | Mol File: | 52328-05-9.mol |  |
| | O-Methylisourea hemisulfate Chemical Properties |
| Melting point | 163-167 °C(lit.) | | vapor pressure | 7.4Pa at 25℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: 0.1 g/mL, clear | | form | Solid | | color | White to Off-White | | biological source | mouse | | Water Solubility | 1000 g/L (20 ºC) | | BRN | 3723107 | | InChI | InChI=1S/2C2H6N2O.H2O4S/c2*1-5-2(3)4;1-5(2,3)4/h2*1H3,(H3,3,4);(H2,1,2,3,4) | | InChIKey | MDFRYRPNRLLJHT-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(O)O.C(=N)(N)OC.C(=N)(N)OC | | LogP | 0.67 at 21℃ | | CAS DataBase Reference | 52328-05-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 1 | | F | 3 | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids |
| | O-Methylisourea hemisulfate Usage And Synthesis |
| Chemical Properties | White crystals or crystalline powder | | Uses | O-Methylisourea Hemisulfate was used as a reagent in the preparation of (D,L)-arginine methyl ester analogs which display antiarrhythmic actiivity. It was also used in the synthesis of ethyl [6-methyl-2-methoxy-3-(substituted phenylethanone)-4-(substituted phenyl)]-1,2,3,4-tetrahydropyrimidine-5-carboxylates which display antimicrobial activity towards mycobacterium tuberculosis, staphylococcus aureus and bacillus subtilis at varying conentration ranges. | | Flammability and Explosibility | Not classified |
| | O-Methylisourea hemisulfate Preparation Products And Raw materials |
|