- Fast Blue BB
-
- $1.00
-
2020-02-02
- CAS:120-00-3
- Min. Order: 1KG
- Purity: 99%HPLC
- Supply Ability: 100KG
|
| | Fast Blue BB Basic information |
| | Fast Blue BB Chemical Properties |
| Melting point | 98-100 °C | | Boiling point | 441.58°C (rough estimate) | | density | 1.0943 (rough estimate) | | refractive index | 1.5486 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Powder or Chunks | | pka | 12.12±0.70(Predicted) | | Colour Index | 37175 | | color | Gray to brown | | BRN | 3416889 | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C17H20N2O3/c1-3-21-15-11-14(16(22-4-2)10-13(15)18)19-17(20)12-8-6-5-7-9-12/h5-11H,3-4,18H2,1-2H3,(H,19,20) | | InChIKey | CNXZLZNEIYFZGU-UHFFFAOYSA-N | | SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1N | | Dissociation constant | 0 at 22℃ | | EPA Substance Registry System | Benzamide, N-(4-amino-2,5-diethoxyphenyl)- (120-00-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-41-37/38 | | Safety Statements | 37/39-26-36/37/39 | | RIDADR | UN 1789 8/PG 2 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29242998 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | Fast Blue BB Usage And Synthesis |
| Chemical Properties | grey to brown powder or chunks | | Uses | Fast Blue BB is a component used in assays that detect virus in clinical specimen. It is also used in test kits that detect micro-organisms infection. Dyes and metabolites. |
| | Fast Blue BB Preparation Products And Raw materials |
|