| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Isoeugenyl phenylacetate, mixture of cis and trans
CAS:120-24-1
Purity:>=97% Package:SAMPLE Remarks:W247707-SAMPLE
|
ISOEUGENYL PHENYLACETATE manufacturers
|
| | ISOEUGENYL PHENYLACETATE Basic information |
| Product Name: | ISOEUGENYL PHENYLACETATE | | Synonyms: | 2-methoxy-4-prop;2-methoxy-4-prop-1-enylphenyl;2-methoxy-4-prop-1-enylphenylphenylacetate;Benzeneaceticacid,2-methoxy-4-(1-propenyl)phenylester;FEMA 2477;ISOEUGENYL PHENYLACETATE;ISOEUGENYL PHENYLACETATE 97+% MIXTURE&;Phenylacetic acid 2-methoxy-4-(1-propenyl)phenyl ester | | CAS: | 120-24-1 | | MF: | C18H18O3 | | MW: | 282.33 | | EINECS: | 204-381-6 | | Product Categories: | Alphabetical Listings;Flavors and Fragrances;I-L | | Mol File: | 120-24-1.mol |  |
| | ISOEUGENYL PHENYLACETATE Chemical Properties |
| density | 1.119 g/mL at 25 °C (lit.) | | FEMA | 2477 | ISOEUGENYL PHENYLACETATE | | refractive index | n20/D 1.577(lit.) | | Fp | >230 °F | | solubility | Insoluble in water, soluble in alcohol and oils. | | form | viscous liquid. | | color | Pale yellowish | | Specific Gravity | 1.15 | | Odor | at 100.00 %. sweet spice clove cinnamon floral honey | | Odor Type | spicy | | biological source | synthetic | | JECFA Number | 1263 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C18H18O3/c1-3-7-14-10-11-16(17(12-14)20-2)21-18(19)13-15-8-5-4-6-9-15/h3-12H,13H2,1-2H3/b7-3+ | | InChIKey | YYLCMLYMJHKLEJ-XVNBXDOJSA-N | | SMILES | COc1cc(\C=C\C)ccc1OC(=O)Cc2ccccc2 | | LogP | 4.29 | | EPA Substance Registry System | Benzeneacetic acid, 2-methoxy-4-(1-propenyl)phenyl ester (120-24-1) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | ISOEUGENYL PHENYLACETATE Usage And Synthesis |
| Description | Isoeugenyl phenylacetate has an intensely sweet odor reminiscent
of carnation. It has a vanilla, clove-like, and honey odor and a
sweet, spicy, slightly fruity flavor. May be prepared from phenylacetyl chloride plus sodium isoeugenol. | | Chemical Properties | Isoeugenyl phenylacetate has an intensely sweet odor reminiscent of carnation. It has a vanilla, clove-like and honey
odor and a sweet, spicy, slightly fruity flavor. | | Uses | Isoeugenyl phenylacetate has found some use in perfume compositions as a Carnation modifier
and fixativ:, as well as in Honey and “Tabac”
type bases, in certain types of Lilac and other
delicate florals. Its very low volatility makes it
suitable as a physical fixative, and its delicate
odor (when reasonably pure) makes it applicable at comparatively high concentration
(4-6-8 %) in the proper bases. It is used in trace amounts in various Spice
blends and imitation fruit and Honey flavors,
particularly those intended for baked goods. | | Preparation | From phenylacetyl chloride plus sodium isoeugenol. | | Taste threshold values | Taste characteristics at 40 ppm: sweet, spice and honey-like with powdery nuances. |
| | ISOEUGENYL PHENYLACETATE Preparation Products And Raw materials |
|