|
|
| | 4-BROMO-7-FLUOROQUINOLINE Basic information |
| | 4-BROMO-7-FLUOROQUINOLINE Chemical Properties |
| Boiling point | 299.7±20.0 °C(Predicted) | | density | 1.647±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.20±0.27(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C9H5BrFN/c10-8-3-4-12-9-5-6(11)1-2-7(8)9/h1-5H | | InChIKey | HKBQHZQGQMDUMR-UHFFFAOYSA-N | | SMILES | BrC1=C2C(C=C(F)C=C2)=NC=C1 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids |
| | 4-BROMO-7-FLUOROQUINOLINE Usage And Synthesis |
| | 4-BROMO-7-FLUOROQUINOLINE Preparation Products And Raw materials |
|