| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Bromo-4,6-difluorobenzenesulfonyl chloride manufacturers
|
| | 2-Bromo-4,6-difluorobenzenesulfonyl chloride Basic information |
| | 2-Bromo-4,6-difluorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 41-44°C | | Boiling point | 266 °F (lit.) | | density | 1.930 g/mL at 25 °C (lit.) | | refractive index | n20/D >1.5660(lit.) | | Fp | >230 °F | | form | liquid | | color | Clear, almost colourless | | Sensitive | Moisture Sensitive | | InChI | 1S/C6H2BrClF2O2S/c7-4-1-3(9)2-5(10)6(4)13(8,11)12/h1-2H | | InChIKey | LBDIILUAEZRJMW-UHFFFAOYSA-N | | SMILES | Fc1cc(F)c(c(Br)c1)S(Cl)(=O)=O | | CAS DataBase Reference | 351003-42-4(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Bromo-4,6-difluorobenzenesulfonyl chloride Usage And Synthesis |
| | 2-Bromo-4,6-difluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|