| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Hydroxy-3-methoxy-d3-phenylethylene glycol 4-sulphate potassium salt Basic information |
| | 4-Hydroxy-3-methoxy-d3-phenylethylene glycol 4-sulphate potassium salt Chemical Properties |
| Melting point | 155-160 °C (dec.) | | storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL | | form | powder | | color | off-white | | Water Solubility | H2O: 50mg/mL | | BRN | 4625651 | | InChI | 1S/C9H12O7S.K/c1-15-9-4-6(7(11)5-10)2-3-8(9)16-17(12,13)14;/h2-4,7,10-11H,5H2,1H3,(H,12,13,14);/q;+1/p-1 | | InChIKey | XFZJWBFZLNLKNR-UHFFFAOYSA-M | | SMILES | [K+].COc1cc(ccc1OS([O-])(=O)=O)C(O)CO |
| WGK Germany | 3 | | F | 3-10-23 | | Storage Class | 11 - Combustible Solids |
| | 4-Hydroxy-3-methoxy-d3-phenylethylene glycol 4-sulphate potassium salt Usage And Synthesis |
| Uses | 4-Hydroxy-3-methoxyphenylglycol Sulfate Potassium Salt is a salt of 4-Hydroxy-3-methoxyphenylglycol Sulfate (3415-67-6) which is a catecholamine metabolite. | | Biochem/physiol Actions | Norepinephrine metabolite that is often used as an index of adrenergic stimulation. |
| | 4-Hydroxy-3-methoxy-d3-phenylethylene glycol 4-sulphate potassium salt Preparation Products And Raw materials |
|