| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 1,2-DI4,7,10,13,16,19 (all-cis) docosahexaenoyl-sn-glycero-3-phosphocholine Basic information |
| Product Name: | 1,2-DI4,7,10,13,16,19 (all-cis) docosahexaenoyl-sn-glycero-3-phosphocholine | | Synonyms: | 22:6 PC (CIS);1,2-DIDOCOSAHEXAENOYL-SN-GLYCERO-3-PHOSPHOCHOLINE;(7R,13Z,16Z,19Z,22Z,25Z,28Z)-4-Hydroxy-N,N,N-trimethyl-10-oxo-7-[[(4Z,7Z,10Z,13Z,16Z,19Z)-1-oxo-4,7,10,13,16,19-docosahexaenyl]oxy]-3,5,9-trioxa-4-phosphahentriaconta-13,16,19,22,25,28-hexaen-1-aminium 4-oxide, inner salt;1,2-Di-(4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoyl)-sn-glycero-3-phosphocholi;[(2R)-2,3-bis[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate;(R)-2,3-Bis(((2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoyl)oxy)propyl (2-(trimethylammonio)ethyl) phosphate;XHN96818;DHAPC | | CAS: | 99296-81-8 | | MF: | C52H80NO8P | | MW: | 878.17 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 1,2-DI4,7,10,13,16,19 (all-cis) docosahexaenoyl-sn-glycero-3-phosphocholine Chemical Properties |
| storage temp. | -20°C | | solubility | Chloroform: soluble | | form | liquid | | pka | 1.160±0.50(predicted) | | color | Colorless to light yellow | | InChIKey | XLKQWAMTMYIQMG-SVUPRYTISA-N | | SMILES | [P](=O)([O-])(OC[C@H](OC(=O)CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)COC(=O)CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)OCC[N+](C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 3
Carc. 2
Eye Irrit. 2
Repr. 2
Skin Irrit. 2
STOT RE 1
STOT SE 3 |
| | 1,2-DI4,7,10,13,16,19 (all-cis) docosahexaenoyl-sn-glycero-3-phosphocholine Usage And Synthesis |
| Uses | 1,2-Didocosahexaenoyl-sn-glycero-3-phosphocholine is used for delivery of polynucleotides encoding interleukin-12. |
| | 1,2-DI4,7,10,13,16,19 (all-cis) docosahexaenoyl-sn-glycero-3-phosphocholine Preparation Products And Raw materials |
|