- 4-Nitroindole
-
- $1.00
-
2026-03-20
- CAS:4769-97-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
- 4-Nitroindole
-
- $100.00
-
2023-08-15
- CAS:4769-97-5
- Min. Order: 1kg
- Purity: 99.99%
- Supply Ability: 50000tons
|
| | 4-Nitroindole Basic information |
| | 4-Nitroindole Chemical Properties |
| Melting point | 205-207 °C (lit.) | | Boiling point | 288.82°C (rough estimate) | | density | 1.3264 (rough estimate) | | refractive index | 1.5770 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Acetone, Dichloromethane, Ethyl Acetate, Methanol | | form | Granular Powder | | pka | 14.76±0.30(Predicted) | | color | Yellow | | BRN | 136022 | | InChI | InChI=1S/C8H6N2O2/c11-10(12)8-3-1-2-7-6(8)4-5-9-7/h1-5,9H | | InChIKey | LAVZKLJDKGRZJG-UHFFFAOYSA-N | | SMILES | N1C2=C(C([N+]([O-])=O)=CC=C2)C=C1 | | CAS DataBase Reference | 4769-97-5(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 68 | | Safety Statements | 45-36/37-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 4-Nitroindole Usage And Synthesis |
| Chemical Properties | Yellow Crystalline Solid | | Uses | 4-Nitroindole is an intermediate for the preparation of indole compounds useful in treatment of pain, inflammation. | | Uses | 4-Nitroindole was used in the synthesis of 1,3,4,5-tetrahydropyrrolo-[4,3,2-de]quinoline. |
| | 4-Nitroindole Preparation Products And Raw materials |
|