|
|
| | Propranolol glucuronide sodium salt Basic information |
| | Propranolol glucuronide sodium salt Chemical Properties |
| Melting point | 153-156°C | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | InChIKey | PCALHJGQCKATMK-DJOOPQPTNA-N | | SMILES | C12C=CC=CC=1C=CC=C2OCC(CNC(C)C)O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](C(=O)O)O1)O |&1:19,20,22,23,25,r| |
| | Propranolol glucuronide sodium salt Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | A metabolite of Propranolol. Antihypertensive; antianginal; antiarrhythmic (class II) | | Definition | ChEBI: Propranolol glucuronide is a glucosiduronic acid. |
| | Propranolol glucuronide sodium salt Preparation Products And Raw materials |
|