| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | Ethyl (S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate Basic information |
| Product Name: | Ethyl (S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate | | Synonyms: | ethyl (S)-trans-4,5-O-isopropyl.-4,5-di-hydroxy-2-pentenoate;Ethyl (S)-trans-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate;ETHYL (S)-(+)-3-(2,2-DIMETHYL-1,3-DIOXOL AN -4-YL)-2-PROPENOATE, 99%, PRED. TRANS;(S)-Ethyl-4,5-isopropylidene-2-pentanoate;Ethyl (S)-trans-4,5-O-isopropylidene-4,5-dihydroxy-2-pentenoate;Ethyl (S)-trans-4,5-O-isopropylidene-4,5-dihydroxy-2-pentenoate, Ethyl (S)-trans-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate;(S,E)-Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)acrylate;ETHYL-(E)-3-[(4S)-2,2-DIMETHYL-1,3-DIOXOLAN-4-YL]-2-PROPENOATE | | CAS: | 64520-58-7 | | MF: | C10H16O4 | | MW: | 200.23 | | EINECS: | | | Product Categories: | chiral | | Mol File: | 64520-58-7.mol |  |
| | Ethyl (S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate Chemical Properties |
| Boiling point | 115-117 °C/12 mmHg (lit.) | | density | 1.035 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.453 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | Specific Gravity | 1.035 | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]20/D +44°, c = 0.5 in chloroform | | BRN | 4231890 | | InChI | 1S/C10H16O4/c1-4-12-9(11)6-5-8-7-13-10(2,3)14-8/h5-6,8H,4,7H2,1-3H3/b6-5+/t8-/m0/s1 | | InChIKey | GZVXALXOWVXZLH-GJIOHYHPSA-N | | SMILES | CCOC(=O)\C=C\[C@H]1COC(C)(C)O1 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 9 | | Storage Class | 10 - Combustible liquids |
| | Ethyl (S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui |
| | Ethyl (S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate Preparation Products And Raw materials |
|