| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,2,3-BENZOTRIAZIN-4(3H)-ONE Basic information |
| Product Name: | 1,2,3-BENZOTRIAZIN-4(3H)-ONE | | Synonyms: | 1,2,3-Benzotriazin-4(3H)-one 98%;1,2,3-benzotriazin-4-(1h)-one;1,2,3-benzotriazin-4(1h)-one;1,2,3-Benzotriazin-4-ol;1,2,3-benzotriazin-4-one;3H-1,2,3-Benzotriazin-4-one;4-keto-(3h)-1,2,3-benzotriazine;4-Ketobenz-1,2,3-triazine | | CAS: | 90-16-4 | | MF: | C7H5N3O | | MW: | 147.13 | | EINECS: | 201-971-5 | | Product Categories: | pharmacetical;Heterocyclic Compounds;Building Blocks;Heterocyclic Building Blocks;Triazines | | Mol File: | 90-16-4.mol |  |
| | 1,2,3-BENZOTRIAZIN-4(3H)-ONE Chemical Properties |
| Melting point | 216-218 °C (lit.) | | Boiling point | 282℃ | | density | 1.47 | | refractive index | 1.5500 (estimate) | | Fp | 125℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in most organic solvents. | | pka | -4.67±0.20(Predicted) | | form | Solid | | color | Needles from cyclohexane | | BRN | 124996 | | Henry's Law Constant | 3.1×104 mol/(m3Pa) at 25℃, HSDB (2015) | | InChI | InChI=1S/C7H5N3O/c11-7-5-3-1-2-4-6(5)8-10-9-7/h1-4H,(H,8,9,11) | | InChIKey | DMSSTTLDFWKBSX-UHFFFAOYSA-N | | SMILES | N1C2=CC=CC=C2C(=O)NN=1 | | CAS DataBase Reference | 90-16-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,2,3-Benzotriazin-4(1H)-one (90-16-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DM0800000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2933698090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 90-16-4(Hazardous Substances Data) | | Toxicity | LD50 ipr-mus: 50 mg/kg NTIS** AD277-689 |
| | 1,2,3-BENZOTRIAZIN-4(3H)-ONE Usage And Synthesis |
| Chemical Properties | Tan powder.
Soluble in alkaline solutions and organic bases. | | Uses | Organic synthesis. | | Uses | 1,2,3-Benzotriazin-4(3H)one is used to prepare 3-methoxymethyl-3H-benzo[d][1,2,3]triazin-4-one by reacting with dimethoxymethane. Further, it undergoes thermal condensation with alfa-amino acids to give 3H-1,4-benzodiazepin-(1H,4H)-2,5-diones. In addition to this, it is employed as a reagent to synthesize 1,2,3-bBenzotriazin-4-one-arylpiperazine derivatives. | | Uses | 1,2,3-Benzotriazin-4(3H)-one is part of a group of compounds that exhibit antimicrobial activity. 1,2,3-Benzotriazin-4(3H)-one is also used as a reagent to synthesize 1,2,3-Benzotriazin-4-one-arylpiperazine derivatives, compounds that act as Serotonin (HCl: S274980) receptor ligands. | | Definition | Bicyclic. | | General Description | 1,2,3-Benzotriazin-4(3H)-one is an 1,2,3-benzotriazine derivative. 1,2,3-Benzotriazin-4(3H)-one undergoes thermal condensation with α-amino acids to yield 3H-1,4-benzodiazepin-(1H,4H)-2,5-diones. 1,2,3-benzotriazin-4(3H)-one on thermolysis yields quinazolino[3,2-c][1,2,3]benzotriazin-8-one. | | Safety Profile | Poison by intraperitoneal route.Experimental reproductive effects. When heated todecomposition it emits toxic fumes of NOx. |
| | 1,2,3-BENZOTRIAZIN-4(3H)-ONE Preparation Products And Raw materials |
|