|
|
| | Isodecyl diphenyl phosphite Basic information | | Uses |
| Product Name: | Isodecyl diphenyl phosphite | | Synonyms: | chelexmd;IRGAFOS DDPP;Di-Phenyl isodecyl Phosphite (DPDP;Isodecyldiphenylphosphit;8-Methylnonyl diphenyl phosphite;JACS-26544-23-0;isodecyldiphenylphosphite;isodecylphenylphosphite | | CAS: | 26544-23-0 | | MF: | C22H31O3P | | MW: | 374.45 | | EINECS: | 247-777-4 | | Product Categories: | | | Mol File: | 26544-23-0.mol |  |
| | Isodecyl diphenyl phosphite Chemical Properties |
| Melting point | 18 °C | | Boiling point | 170℃ | | density | 1.03g/mL (25℃) | | refractive index | 1.516~1.519 | | Fp | 154℃ | | solubility | Soluble in most organic solvents, insoluble in water. | | form | transparent liquid | | color | Colourless or light yellow | | Viscosity | 10.3mPa.s (38℃) | | InChI | InChI=1S/C22H31O3P/c1-20(2)14-8-4-3-5-13-19-23-26(24-21-15-9-6-10-16-21)25-22-17-11-7-12-18-22/h6-7,9-12,15-18,20H,3-5,8,13-14,19H2,1-2H3 | | InChIKey | ADRNSOYXKABLGT-UHFFFAOYSA-N | | SMILES | P(OCCCCCCCC(C)C)(OC1=CC=CC=C1)OC1=CC=CC=C1 | | EPA Substance Registry System | Isodecyl diphenyl phosphite (26544-23-0) |
| | Isodecyl diphenyl phosphite Usage And Synthesis |
| Uses | Diphenyl isodecyl phosphite (DPDP) is a phosphite-based antioxidant. DPDP is mainly used as a color-retention and processing stabilizer in polycarbonate, polyurethane, ABS resin, coatings, etc., such as in polyether-type flexible foam and RIM polyurethane. | | Hazard | A mild eye irritant. |
| | Isodecyl diphenyl phosphite Preparation Products And Raw materials |
|