|
|
| | 3,8-DIAMINO-6-PHENYLPHENANTHRIDINE Basic information |
| | 3,8-DIAMINO-6-PHENYLPHENANTHRIDINE Chemical Properties |
| Melting point | 196-198 °C (lit.) | | Boiling point | 558.0±45.0 °C(Predicted) | | density | 1.292±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in chloroform, dichloromethane and methanol. | | form | Solid | | pka | 5.96±0.30(Predicted) | | color | Yellow | | InChI | InChI=1S/C19H15N3/c20-13-6-8-15-16-9-7-14(21)11-18(16)22-19(17(15)10-13)12-4-2-1-3-5-12/h1-11H,20-21H2 | | InChIKey | CPNAVTYCORRLMH-UHFFFAOYSA-N | | SMILES | C1C2C(=NC(C3=CC=CC=C3)=C3C=2C=CC(N)=C3)C=C(N)C=1 | | CAS DataBase Reference | 52009-64-0(CAS DataBase Reference) |
| | 3,8-DIAMINO-6-PHENYLPHENANTHRIDINE Usage And Synthesis |
| Chemical Properties | Crystaline Yellow Solid | | Uses | 3,8-Diamino-6-phenylphenanthridine is used in the synthesis of rigid polyamides. It has anti-tumor and anti-viral properties. | | Uses | Used in the synthesis of rigid polyamides. It has been investigated for its anti-tumor and anti-viral properties. Small organic molecules, such as 3,8-Diamino-6-phenylphenanthridine, can bind to DNA by means of a non-specific binding along the DNA exterior. |
| | 3,8-DIAMINO-6-PHENYLPHENANTHRIDINE Preparation Products And Raw materials |
|