| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 4-beta-Galactobiose Basic information |
| Product Name: | 4-beta-Galactobiose | | Synonyms: | β-d-gal-(1→4)-d-gal;4-b-Galactobiose;β-D-Gal-(1-4)-D-Gal, 4-O-β-D-Galactopyranosyl-D-galactopyranose;4-β-Galactobiose ,98%;4-O-BETA-D-GALACTOPYRANOSYL-D-GALACTOPYRANOSE;GAL-BETA1-4GAL;BETA-1-4-GALACTOSYL-GALACTOSE;BETA-D-GAL-[1->4]-D-GAL | | CAS: | 2152-98-9 | | MF: | C12H22O11 | | MW: | 342.3 | | EINECS: | | | Product Categories: | | | Mol File: | 2152-98-9.mol |  |
| | 4-beta-Galactobiose Chemical Properties |
| storage temp. | 2-8°C | | form | powder or solid | | biological source | synthetic | | InChI | InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10+,11,12+/s3 | | InChIKey | GUBGYTABKSRVRQ-FBQYNQMYNA-N | | SMILES | [C@H]1([C@H](O)[C@H](C(O)O[C@@H]1CO)O)O[C@H]1[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O |&1:0,1,3,7,12,13,15,16,18,r| |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 4-beta-Galactobiose Usage And Synthesis |
| Chemical Properties | solid | | Definition | ChEBI: Beta-D-galactopyranosyl-(1->4)-D-galactopyranose is a glycosylgalactose comprising two galactose units joined via an beta-(1->4) linkage. |
| | 4-beta-Galactobiose Preparation Products And Raw materials |
|