|
|
| | 1,8-DINITROANTHRAQUINONE Basic information |
| Product Name: | 1,8-DINITROANTHRAQUINONE | | Synonyms: | 1,8-dinitro-10-anthracenedione;1,8-Dinitro-9,10-anthracenedione;10-Anthracenedione,1,8-dinitro-9;1,8-DINITROANTHRAQUINONE;1,8-DINITRO ANTHRAQUINONE 97% MIN;1,8-Dinitro-9,10-anthraquinone;1,8-Dinitroanthraquinone 97%;9,10-Anthracenedione, 1,8-dinitro- | | CAS: | 129-39-5 | | MF: | C14H6N2O6 | | MW: | 298.21 | | EINECS: | 204-943-0 | | Product Categories: | Intermediates of Dyes and Pigments;C13 to C14;Carbonyl Compounds;Ketones | | Mol File: | 129-39-5.mol |  |
| | 1,8-DINITROANTHRAQUINONE Chemical Properties |
| Melting point | 318-322 °C (lit.) | | Boiling point | 563.4±50.0 °C(Predicted) | | density | 1.631±0.06 g/cm3(Predicted) | | storage temp. | -20°C, Inert atmosphere | | solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) | | form | Solid | | color | Yellow | | InChI | InChI=1S/C14H6N2O6/c17-13-7-3-1-5-9(15(19)20)11(7)14(18)12-8(13)4-2-6-10(12)16(21)22/h1-6H | | InChIKey | MBIJFIUDKPXMAV-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=C2C(C(=O)C3=C(C2=O)C([N+]([O-])=O)=CC=C3)=CC=C1 | | EPA Substance Registry System | 9,10-Anthracenedione, 1,8-dinitro- (129-39-5) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2914790090 | | Storage Class | 4.1A - Other explosive hazardous materials |
| | 1,8-DINITROANTHRAQUINONE Usage And Synthesis |
| Chemical Properties | Crystallized in acetic anhydride, it is yellow prisms. Slightly soluble in common organic solvents. | | Uses | 1,8-Dinitroanthracene-9,10-dione is used in preparation method of disperse dyes using 1-aminoanthraquinone DMF residue. |
| | 1,8-DINITROANTHRAQUINONE Preparation Products And Raw materials |
|